What is the IUPAC name of ethoxydiglycol acetate?
The IUPAC name of ethoxydiglycol acetate is 2-(2-Ethoxyethoxy)ethyl acetate.
What is the molecular weight of ethoxydiglycol acetate?
The molecular weight of ethoxydiglycol acetate is 176.21.
What is the molecular formula of ethoxydiglycol acetate?
The molecular formula of ethoxydiglycol acetate is C8H16O4.
What is the boiling point of ethoxydiglycol acetate?
The boiling point of ethoxydiglycol acetate is 218-219 °C.
What is the physical state of ethoxydiglycol acetate?
Ethoxydiglycol acetate is in liquid form.
What are some typical applications of ethoxydiglycol acetate?
Ethoxydiglycol acetate can be used as a solvent, a cleansing agent, and a paint stripper.
What is the density of ethoxydiglycol acetate?
The density of ethoxydiglycol acetate is 1.011g/ml.
What is the CAS number of ethoxydiglycol acetate?
The CAS number of ethoxydiglycol acetate is 112-15-2.
What are some synonyms for ethoxydiglycol acetate?
Some synonyms for ethoxydiglycol acetate are 2-(2-Ethoxyethoxy)ethyl acetate and Ethanol, 2-(2-ethoxyethoxy)-, acetate.
What are the SMILES and InChI representations of ethoxydiglycol acetate?
The SMILES representation of ethoxydiglycol acetate is CCOCCOCCOC(=O)C and the InChI representation is InChI=1S/C8H16O4/c1-3-10-4-5-11-6-7-12-8(2)9/h3-7H2,1-2H3.
PAGE TOP