
What is the PubChem CID for estradiol?
The PubChem CID for estradiol is 5757.
What is the molecular formula of estradiol?
The molecular formula of estradiol is C18H24O2.
What are the synonyms for estradiol?
The synonyms for estradiol are beta-Estradiol, 17beta-Estradiol, and Oestradiol.
What is the molecular weight of estradiol?
The molecular weight of estradiol is 272.4 g/mol.
What is the IUPAC name of estradiol?
The IUPAC name of estradiol is (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
What is the InChIKey of estradiol?
The InChIKey of estradiol is VOXZDWNPVJITMN-ZBRFXRBCSA-N.
What is the canonical SMILES of estradiol?
The canonical SMILES of estradiol is CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O.
What is the CAS number for estradiol?
The CAS number for estradiol is 50-28-2.
What is the ChEMBL ID of estradiol?
The ChEMBL ID of estradiol is CHEMBL135.
What is the UNII for estradiol?
The UNII for estradiol is 4TI98Z838E.