What is the molecular formula of Erythrulose?
The molecular formula of Erythrulose is C4H8O4.
What are some synonyms for Erythrulose?
Some synonyms for Erythrulose are 1,3,4-trihydroxybutan-2-one, glycero-tetrulose, and tetrulose.
What is the molecular weight of Erythrulose?
The molecular weight of Erythrulose is 120.10 g/mol.
When was Erythrulose first created and modified?
Erythrulose was first created on June 24, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Erythrulose?
The IUPAC name of Erythrulose is 1,3,4-trihydroxybutan-2-one.
What is the InChI of Erythrulose?
The InChI of Erythrulose is InChI=1S/C4H8O4/c5-1-3(7)4(8)2-6/h3,5-7H,1-2H2.
What is the Canonical SMILES of Erythrulose?
The Canonical SMILES of Erythrulose is C(C(C(=O)CO)O)O.
What is the CAS number of Erythrulose?
The CAS number of Erythrulose is 40031-31-0.
How many hydrogen bond donor counts does Erythrulose have?
Erythrulose has 3 hydrogen bond donor counts.
How many topological polar surface area does Erythrulose have?
Erythrulose has a topological polar surface area of 77.8 ?2.