
What is the IUPAC name for Erythorbic acid?
The IUPAC name for Erythorbic acid is (2R)-2-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one.
What is the molecular formula of Erythorbic acid?
The molecular formula of Erythorbic acid is C6H8O6.
What is the boiling point of Erythorbic acid?
The boiling point of Erythorbic acid is 227.5°C.
What is the melting point of Erythorbic acid?
The melting point of Erythorbic acid is 169-172 °C.
What is the density of Erythorbic acid?
The density of Erythorbic acid is 1.374 g/ml.
What are some synonyms for Erythorbic acid?
Some synonyms for Erythorbic acid are Isovitamin C, D-Isoascorbic acid, and 2,3-Didehydro-D-erythro-hexono-1,4-lactone.
What are the typical applications of Erythorbic acid?
The typical applications of Erythorbic acid include being used as an antioxidant and color-protecting agent.
What is the percentage of actives in Erythorbic acid?
The percentage of actives in Erythorbic acid is 95%.
What is the CAS number of Erythorbic acid?
The CAS number of Erythorbic acid is 89-65-6.
How is the molecular structure of Erythorbic acid represented in the SMILES notation?
The molecular structure of Erythorbic acid is represented in the SMILES notation as C([C@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O.