We use cookies to understand how you use our site and to improve the overall user experience. This includes personalizing content and advertising. Read our Privacy Policy
What is the product name of the compound with CAS number 112-65-2?
The product name of the compound is Dodecylguanidine.
What is the IUPAC name of the compound with CAS number 112-65-2?
The IUPAC name of the compound is 2-Dodecylguanidine.
What is the molecular weight of Dodecylguanidine?
The molecular weight of Dodecylguanidine is 227.39.
What is the molecular formula of Dodecylguanidine?
The molecular formula of Dodecylguanidine is C13H29N3.
What is the SMILES notation for Dodecylguanidine?
The SMILES notation for Dodecylguanidine is CCCCCCCCCCCCN=C(N)N.
What is the InChI key for Dodecylguanidine?
The InChI key for Dodecylguanidine is InChI=1S/C13H29N3/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15/h2-12H2,1H3,(H4,14,15,16)
What is the physical state of Dodecylguanidine?
Dodecylguanidine is in a solid physical state.
What is the typical application of Dodecylguanidine?
The typical application of Dodecylguanidine is as an antimicrobial agent.
What percentage of actives does Dodecylguanidine contain?
Dodecylguanidine contains 95% actives.
What are some synonyms for Dodecylguanidine?
Some synonyms for Dodecylguanidine are Guanidine, dodecyl-.
PAGE TOP