What is the CAS number for DL-Menthyl acetate?
The CAS number for DL-Menthyl acetate is 89-48-5.
What are some synonyms for DL-Menthyl acetate?
Some synonyms for DL-Menthyl acetate include Menthyl acetate.
What is the molecular weight of DL-Menthyl acetate?
The molecular weight of DL-Menthyl acetate is 198.3.
What is the molecular formula of DL-Menthyl acetate?
The molecular formula of DL-Menthyl acetate is C12H22O2.
What is the InChI Key for DL-Menthyl acetate?
The InChI Key for DL-Menthyl acetate is InChI=1S/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3.
What is the boiling point of DL-Menthyl acetate?
The boiling point of DL-Menthyl acetate is 228-229 °C (lit.).
What is the melting point of DL-Menthyl acetate?
The melting point of DL-Menthyl acetate is 25°C.
What is the density of DL-Menthyl acetate?
The density of DL-Menthyl acetate is 0.922g/ml.
What is the percentage of actives in DL-Menthyl acetate?
The percentage of actives in DL-Menthyl acetate is 95%.
What is a typical application of DL-Menthyl acetate?
A typical application of DL-Menthyl acetate is in perfume.
PAGE TOP