What is the CAS number of Dipentaerythrityl hexa C5-9 acid esters?
The CAS number is 67762-52-1.
What are some synonyms of Dipentaerythrityl hexa C5-9 acid esters?
Some synonyms are Carboxylic acids, C5-9, hexaesters with dipentaerythritol.
What is the IUPAC name of Dipentaerythrityl hexa C5-9 acid esters?
The IUPAC name is [3-Hydroxy-2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propyl] pentanoate.
What is the SMILES representation of Dipentaerythrityl hexa C5-9 acid esters?
The SMILES representation of Dipentaerythrityl hexa C5-9 acid esters is CCCCC(=O)OCC(CO)(CO)COCC(CO)(CO)CO.
What is the InChI of Dipentaerythrityl hexa C5-9 acid esters?
The InChI of Dipentaerythrityl hexa C5-9 acid esters is InChI=1S/C15H30O8/c1-2-3-4-13(21)23-12-15(8-19,9-20)11-22-10-14(5-16,6-17)7-18/h16-20H,2-12H2,1H3.
What is the percentage of actives in Dipentaerythrityl hexa C5-9 acid esters?
Dipentaerythrityl hexa C5-9 acid esters has 95% actives.
What is the physical state of Dipentaerythrityl hexa C5-9 acid esters?
The physical state is liquid.
What are some typical applications of Dipentaerythrityl hexa C5-9 acid esters?
Some typical applications of Dipentaerythrityl hexa C5-9 acid esters are skin and hair conditioning, and plasticizer.
Can you describe the molecular structure of Dipentaerythrityl hexa C5-9 acid esters?
The molecular structure of Dipentaerythrityl hexa C5-9 acid esters consists of a pentanoate group attached to a dipentaerythritol molecule with multiple hydroxymethyl and hydroxy groups.