What is the CAS number for Dimyristyl tartrate?
The CAS number for Dimyristyl tartrate is 94237-18-0.
What are some synonyms for Dimyristyl tartrate?
Some synonyms for Dimyristyl tartrate are 2,3-Dihydroxybutanedioic acid, ditetradecyl ester.
What is the IUPAC name for Dimyristyl tartrate?
The IUPAC name for Dimyristyl tartrate is Ditetradecyl (2R,3R)-2,3-dihydroxybutanedioate.
What is the molecular weight of Dimyristyl tartrate?
The molecular weight of Dimyristyl tartrate is 542.83.
What is the molecular formula of Dimyristyl tartrate?
The molecular formula of Dimyristyl tartrate is C32H62O6.
What is the SMILES representation of Dimyristyl tartrate?
The SMILES representation of Dimyristyl tartrate is CCCCCCCCCCCCCCOC(=O)[C@@H]([C@H](C(=O)OCCCCCCCCCCCCCC)O)O.
What is the InChI for Dimyristyl tartrate?
The InChI for Dimyristyl tartrate is InChI=1S/C32H62O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-37-31(35)29(33)30(34)32(36)38-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h29-30,33-34H,3-28H2,1-2H3/t29-,30-/m1/s1.
What is the percentage of actives in Dimyristyl tartrate?
The percentage of actives in Dimyristyl tartrate is 95%.
What is the physical state of Dimyristyl tartrate?
The physical state of Dimyristyl tartrate is solid.
What are some typical applications of Dimyristyl tartrate?
Some typical applications of Dimyristyl tartrate are emollient and skin conditioning.