What is the CAS number for Dimethylsilanol hyaluronate?
The CAS number for Dimethylsilanol hyaluronate is 135507-00-5.
What are some synonyms for Dimethylsilanol hyaluronate?
Some synonyms for Dimethylsilanol hyaluronate are Hyaluronic acid, dimethylsilyl ester.
What is the chemical formula of Dimethylsilanol hyaluronate?
The chemical formula of Dimethylsilanol hyaluronate is C32H54N2O23Si2.
What is the InChI key for Dimethylsilanol hyaluronate?
The InChI key for Dimethylsilanol hyaluronate is InChI=1S/C32H54N2O23Si2.
What is the physical state of Dimethylsilanol hyaluronate?
Dimethylsilanol hyaluronate is in liquid physical state.
What is the percentage of actives in Dimethylsilanol hyaluronate?
Dimethylsilanol hyaluronate contains 1% actives.
What are the typical applications of Dimethylsilanol hyaluronate?
The typical applications of Dimethylsilanol hyaluronate include as a humectant.
What is the SMILES representation of Dimethylsilanol hyaluronate?
The SMILES representation of Dimethylsilanol hyaluronate is CC(=O)NC1C(C(C(OC1O)CO)O)OC2C(C(C(C(O2)C(=O)O[Si](C)C)OC3C(C(C(C(O3)CO)O)OC4C(C(C(C(O4)C(=O)O[Si](C)C)O)O)O)NC(=O)C)O)O.
What is unique about the chemical structure of Dimethylsilanol hyaluronate?
One thing that is unique about the chemical structure of Dimethylsilanol hyaluronate is the presence of silicon in the molecule.
How is Dimethylsilanol hyaluronate commonly used in skincare products?
Dimethylsilanol hyaluronate is commonly used in skincare products as a humectant to help retain moisture in the skin.