What is the CAS number for Dimethyl capramide?
The CAS number for Dimethyl capramide is 14433-76-2.
What are some synonyms for Dimethyl capramide?
Some synonyms for Dimethyl capramide are Decanamide, N,N-dimethyl- and N,N-Dimethyldecan-1-amide.
What is the IUPAC Name for Dimethyl capramide?
The IUPAC Name for Dimethyl capramide is N,N-dimethyldecanamide.
What is the molecular weight of Dimethyl capramide?
The molecular weight of Dimethyl capramide is 199.33.
What is the molecular formula of Dimethyl capramide?
The molecular formula of Dimethyl capramide is C12H25NO.
What is the density of Dimethyl capramide?
The density of Dimethyl capramide is 0.922g/ml.
What is the percentage of actives in Dimethyl capramide?
The percentage of actives in Dimethyl capramide is 95%.
What is the physical state of Dimethyl capramide?
The physical state of Dimethyl capramide is liquid.
What are some typical applications of Dimethyl capramide?
Some typical applications of Dimethyl capramide are as a dispersing agent, an emulsifying agent, and a lubricant.
What is the InChI Key for Dimethyl capramide?
The InChI Key for Dimethyl capramide is InChI=1S/C12H25NO/c1-4-5-6-7-8-9-10-11-12(14)13(2)3/h4-11H2,1-3H3.
PAGE TOP