What is the CAS number for Dihydrocitronellol?
The CAS number for Dihydrocitronellol is 106-21-8.
What are some synonyms for Dihydrocitronellol?
Some synonyms for Dihydrocitronellol are Geraniol tetrahydride.
What is the molecular weight of Dihydrocitronellol?
The molecular weight of Dihydrocitronellol is 158.28.
What is the molecular formula of Dihydrocitronellol?
The molecular formula of Dihydrocitronellol is C10H22O.
What is the InChI for Dihydrocitronellol?
The InChI for Dihydrocitronellol is InChI=1S/C10H22O/c1-9(2)5-4-6-10(3)7-8-11/h9-11H,4-8H2,1-3H3.
What is the boiling point of Dihydrocitronellol?
The boiling point of Dihydrocitronellol is 98-99 °C.
What is the melting point of Dihydrocitronellol?
The melting point of Dihydrocitronellol is -1.53 °C.
What is the flash point of Dihydrocitronellol?
The flash point of Dihydrocitronellol is 203 °F.
What is the purity of Dihydrocitronellol?
The purity of Dihydrocitronellol is 95%+.
What are some typical applications of Dihydrocitronellol?
Some typical applications of Dihydrocitronellol are use as a dispersing agent, emulsifying agent, lubricant, and intermediate in organic synthesis.
PAGE TOP