
What is the IUPAC name of Diethylhexylamine?
The IUPAC name of Diethylhexylamine is 2-Ethyl-N-(2-ethylhexyl)hexan-1-amine.
What is the molecular weight of Diethylhexylamine?
The molecular weight of Diethylhexylamine is 241.46.
What is the chemical formula of Diethylhexylamine?
The chemical formula of Diethylhexylamine is C16H35N.
What is the boiling point of Diethylhexylamine?
The boiling point of Diethylhexylamine is 123 °C at 5mmHg.
What is the melting point of Diethylhexylamine?
The melting point of Diethylhexylamine is -60 °C.
What is the density of Diethylhexylamine?
The density of Diethylhexylamine is 0.805g/ml.
What is the percentage of actives in Diethylhexylamine?
The percentage of actives in Diethylhexylamine is 95%.
What are some typical applications of Diethylhexylamine?
Some typical applications of Diethylhexylamine are use as an antistatic agent, emulsifying agent, dispersing agent, corrosion inhibitor, and lubricant.
What are some synonyms of Diethylhexylamine?
Some synonyms of Diethylhexylamine are 1-Hexanamine, 2-ethyl-N-(2-ethylhexyl)- and Di(2-ethylhexyl)amine.
What is the InChI key of Diethylhexylamine?
The InChI key of Diethylhexylamine is InChI=1S/C16H35N/c1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2/h15-17H,5-14H2,1-4H3.