What is the IUPAC name of Diethoxyethyl succinate?
The IUPAC name of Diethoxyethyl succinate is Bis(2-ethoxyethyl) butanedioate.
What is the molecular weight of Diethoxyethyl succinate?
The molecular weight of Diethoxyethyl succinate is 262.3.
What is another name for Diethoxyethyl succinate?
Another name for Diethoxyethyl succinate is Bis(2-ethoxyethyl)succinate.
What is the boiling point of Diethoxyethyl succinate?
The boiling point of Diethoxyethyl succinate is 327.5±22.0 °C.
What is the density of Diethoxyethyl succinate?
The density of Diethoxyethyl succinate is 1.064±0.06g/ml.
What is the CAS number of Diethoxyethyl succinate?
The CAS number of Diethoxyethyl succinate is 26962-29-8.
What is the molecular formula of Diethoxyethyl succinate?
The molecular formula of Diethoxyethyl succinate is C12H22O6.
What are the typical applications of Diethoxyethyl succinate?
The typical applications of Diethoxyethyl succinate include use as a solvent, cleansing agent, and solubilizing agent.
What is the percentage of actives in Diethoxyethyl succinate?
The percentage of actives in Diethoxyethyl succinate is 95%.
Can you provide the SMILES notation for Diethoxyethyl succinate?
The SMILES notation for Diethoxyethyl succinate is CCOCCOC(=O)CCC(=O)OCCOCC.