
What is the IUPAC name of Dibutylene tetrafurfural?
The IUPAC name of Dibutylene tetrafurfural is 4,5a,6,9,9a,9b-Hexahydro-1H-dibenzofuran-4a-carbaldehyde.
What is the molecular weight of Dibutylene tetrafurfural?
The molecular weight of Dibutylene tetrafurfural is 204.26.
What is the CAS number of Dibutylene tetrafurfural?
The CAS number of Dibutylene tetrafurfural is 126-15-8.
What is the physical state of Dibutylene tetrafurfural?
Dibutylene tetrafurfural is in a liquid state.
What is the typical application of Dibutylene tetrafurfural?
The typical application of Dibutylene tetrafurfural is as an insect repellent.
What is the melting point of Dibutylene tetrafurfural?
The melting point of Dibutylene tetrafurfural is -80 °C.
What is the molecular formula of Dibutylene tetrafurfural?
The molecular formula of Dibutylene tetrafurfural is C13H16O2.
What is the percentage of actives in Dibutylene tetrafurfural?
The percentage of actives in Dibutylene tetrafurfural is 95%.
What is the SMILES notation of Dibutylene tetrafurfural?
The SMILES notation of Dibutylene tetrafurfural is C1C=CCC2C1C3CC=CCC3(O2)C=O.
What is the InChI Key of Dibutylene tetrafurfural?
The InChI Key of Dibutylene tetrafurfural is InChI=1S/C13H16O2/c14-9-13-8-4-3-6-11(13)10-5-1-2-7-12(10)15-13/h1-4,9-12H,5-8H2.