What is the CAS number of Decyl myristate?
The CAS number of Decyl myristate is 41927-71-3.
What are some synonyms for Decyl myristate?
Some synonyms for Decyl myristate are Decyl tetradecanoate.
What is the molecular formula of Decyl myristate?
The molecular formula of Decyl myristate is C24H48O2.
What is the molecular weight of Decyl myristate?
The molecular weight of Decyl myristate is 368.64.
What is the SMILES representation of Decyl myristate?
The SMILES representation of Decyl myristate is CCCCCCCCCCCCCC(=O)OCCCCCCCCCC.
What is the InChI Key of Decyl myristate?
The InChI Key of Decyl myristate is InChI=1S/C24H48O2/c1-3-5-7-9-11-13-14-15-16-18-20-22-24(25)26-23-21-19-17-12-10-8-6-4-2/h3-23H2,1-2H3.
What is the boiling point of Decyl myristate?
The boiling point of Decyl myristate is 414.2ºC at 760 mmHg.
What is the flash point of Decyl myristate?
The flash point of Decyl myristate is 209.9ºC.
What is the purity of Decyl myristate?
The purity of Decyl myristate is 96%.
What are the typical applications of Decyl myristate?
Decyl myristate is commonly used as an emollient in skincare products.
PAGE TOP