
What is the CAS number for Decyl isostearate?
The CAS number for Decyl isostearate is 84605-08-3.
What are the synonyms for Decyl isostearate?
The synonyms for Decyl isostearate are Decyl isooctadecanoate and Decyl 16-methylheptadecanoate.
What is the molecular weight of Decyl isostearate?
The molecular weight of Decyl isostearate is 427.74.
What is the molecular formula of Decyl isostearate?
The molecular formula of Decyl isostearate is C28H56O2.
What is the SMILES notation for Decyl isostearate?
The SMILES notation for Decyl isostearate is CCCCCCCCCCOC(=O)CCCCCCCCCCCCCCC(C)C.
What is the InChI key for Decyl isostearate?
The InChI key for Decyl isostearate is InChI=1S/C28H56O2/c1-4-5-6-7-8-17-20-23-26-30-28(29)25-22-19-16-14-12-10-9-11-13-15-18-21-24-27(2)3/h27H,4-26H2,1-3H3.
What is the percentage of actives in Decyl isostearate?
The percentage of actives in Decyl isostearate is 95%.
What is the physical state of Decyl isostearate?
The physical state of Decyl isostearate is a liquid.
What are the typical applications of Decyl isostearate?
The typical applications of Decyl isostearate are as an emollient and for skin conditioning.
How can Decyl isostearate be described in terms of its chemical composition?
Decyl isostearate can be described as a fatty acid ester with a 16-carbon chain length and the presence of a methyl group.