What is the product name of the compound with CAS number 26402-22-2?
The product name of the compound is Decanoic acid, monoester with 1,2,3-propanetriol.
What are some synonyms for the compound?
Some synonyms for the compound include Glyceryl caprate, Glyceryl monocaprate, and Decanoic acid, monoester with glycerol.
What is the molecular weight of the compound?
The molecular weight of the compound is 246.34.
What is the molecular formula of the compound?
The molecular formula of the compound is C13H26O4.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2,3-Dihydroxypropyl decanoate.
What is the melting point of the compound?
The melting point of the compound is 53 °C.
What is the physical state of the compound?
The physical state of the compound is solid.
What are some typical applications of the compound?
Some typical applications of the compound include use as a lubricant and use as a dispersing agent and emulsion stabilizer.
What is the percentage of actives in the compound?
The percentage of actives in the compound is 95%.
What is the InChI key of the compound?
The InChI key of the compound is InChI=1S/C13H26O4/c1-2-3-4-5-6-7-8-9-13(16)17-11-12(15)10-14/h12,14-15H,2-11H2,1H3.
PAGE TOP