What is the CAS number for Decanedioic acid, bis(2-ethylhexyl) ester?
The CAS number is 122-62-3.
What are some synonyms for Decanedioic acid, bis(2-ethylhexyl) ester?
Some synonyms include Bis(2-ethylhexyl) sebacate, Bis(2-ethylhexyl) decanedioate, and Di-2-ethylhexyl sebacate.
What is the molecular weight of Decanedioic acid, bis(2-ethylhexyl) ester?
The molecular weight is 426.67 g/mol.
What is the molecular formula of Decanedioic acid, bis(2-ethylhexyl) ester?
The molecular formula is C26H50O4.
What is the SMILES notation for Decanedioic acid, bis(2-ethylhexyl) ester?
The SMILES notation is CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC.
What is the InChI for Decanedioic acid, bis(2-ethylhexyl) ester?
The InChI is InChI=1S/C26H50O4/c1-5-9-17-23(7-3)21-29-25(27)19-15-13-11-12-14-16-20-26(28)30-22-24(8-4)18-10-6-2/h23-24H,5-22H2,1-4H3.
What is the boiling point of Decanedioic acid, bis(2-ethylhexyl) ester?
The boiling point is 212 °C at 1mmHg.
What is the melting point of Decanedioic acid, bis(2-ethylhexyl) ester?
The melting point is -55 °C.
What is the density of Decanedioic acid, bis(2-ethylhexyl) ester?
The density is 0.914g/ml.
What are some typical applications of Decanedioic acid, bis(2-ethylhexyl) ester?
Some typical applications include use as a lubricant, as a lubricating oil for vacuum pump and motor, and as a dispersing agent and emulsion stabilizer.
PAGE TOP