
What is the IUPAC name of the product D-Glucopyranose, oligomeric, C10-16-alkyl glycosides?
The IUPAC name is (3R,4S,5S,6R)-2-dodecoxy-6-(hydroxymethyl)oxane-3,4,5-triol.
What is the CAS number of D-Glucopyranose, oligomeric, C10-16-alkyl glycosides?
The CAS number is 110615-47-9.
What are the synonyms for D-Glucopyranose, oligomeric, C10-16-alkyl glycosides?
The synonyms are C10-16 Alkyl Glucoside and D-Glucopyranoside, C10-16-alkyl, oligomeric.
What is the molecular formula of D-Glucopyranose, oligomeric, C10-16-alkyl glycosides?
The molecular formula is C18H36O6.
What is the percentage of actives present in D-Glucopyranose, oligomeric, C10-16-alkyl glycosides?
The product contains 95% actives.
What are some typical applications of D-Glucopyranose, oligomeric, C10-16-alkyl glycosides?
It is used as a cleansing agent in personal care products, household cleaning, food, industrial cleaning, and textile industries.
Can D-Glucopyranose, oligomeric, C10-16-alkyl glycosides be used with high alkali content?
Yes, it can be used at high alkali content.
What is the physical state of D-Glucopyranose, oligomeric, C10-16-alkyl glycosides?
It can exist in both solid and liquid states.
What is the SMILES representation of D-Glucopyranose, oligomeric, C10-16-alkyl glycosides?
The SMILES representation is CCCCCCCCCCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O.
What is the InChI key of D-Glucopyranose, oligomeric, C10-16-alkyl glycosides?
The InChI key is InChI=1S/C18H36O6/c1-2-3-4-5-6-7-8-9-10-11-12-23-18-17(22)16(21)15(20)14(13-19)24-18/h14-22H,2-13H2,1H3/t14-,15-,16+,17-,18?/m1/s1.