What is the IUPAC name of the compound D-Chiro-Inositol?
The IUPAC name of the compound D-Chiro-Inositol is cyclohexane-1,2,3,4,5,6-hexol.
What is the molecular weight of D-Chiro-Inositol?
The molecular weight of D-Chiro-Inositol is 180.16.
What is the molecular formula of D-Chiro-Inositol?
The molecular formula of D-Chiro-Inositol is C6H12O6.
What is the SMILES notation for D-Chiro-Inositol?
The SMILES notation for D-Chiro-Inositol is C1(C(C(C(C(C1O)O)O)O)O)O.
What is the InChI Key for D-Chiro-Inositol?
The InChI Key for D-Chiro-Inositol is CDAISMWEOUEBRE-UHFFFAOYSA-N.
What is the boiling point of D-Chiro-Inositol?
The boiling point of D-Chiro-Inositol is 291.326°C at 760 mmHg.
What is the melting point of D-Chiro-Inositol?
The melting point of D-Chiro-Inositol is 230°C.
What is the purity of D-Chiro-Inositol?
The purity of D-Chiro-Inositol is 98%.
What is the physical state of D-Chiro-Inositol?
The physical state of D-Chiro-Inositol is solid.
What are the typical applications of D-Chiro-Inositol?
Some typical applications of D-Chiro-Inositol include its use as a dispersing agent and emulsifying agent, as well as an intermediate in organic synthesis.
PAGE TOP