What is the CAS number for Coumarin?
The CAS number for Coumarin is 91-64-5.
What are some synonyms for Coumarin?
Some synonyms for Coumarin include 2-Oxo-1,2-benzopyran and Chromen-2-one.
What is the molecular weight of Coumarin?
The molecular weight of Coumarin is 146.14.
What is the molecular formula of Coumarin?
The molecular formula of Coumarin is C9H6O2.
What is the SMILES notation for Coumarin?
The SMILES notation for Coumarin is C1=CC=C2C(=C1)C=CC(=O)O2.
What is the InChI for Coumarin?
The InChI for Coumarin is InChI=1S/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H.
What is the boiling point of Coumarin?
The boiling point of Coumarin is 298 °C.
What is the melting point of Coumarin?
The melting point of Coumarin is 68-73 °C.
What is the purity of Coumarin?
The purity of Coumarin is 98%+.
What are the typical applications of Coumarin?
The typical application of Coumarin is for use as a perfume.
PAGE TOP