
What is the molecular formula of citric acid?
The molecular formula of citric acid is C6H8O7.
What are some synonyms for citric acid?
Some synonyms for citric acid are citric acid, anhydrous, 2-hydroxypropane-1,2,3-tricarboxylic acid, and anhydrous citric acid.
What is the molecular weight of citric acid?
The molecular weight of citric acid is 192.12 g/mol.
What is the role of citric acid as?
Citric acid has a role as a food acidity regulator, a chelator, an antimicrobial agent, and a fundamental metabolite.
What is the IUPAC name of citric acid?
The IUPAC name of citric acid is 2-hydroxypropane-1,2,3-tricarboxylic acid.
What is the InChI code for citric acid?
The InChI code for citric acid is InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12).
What is the Canonical SMILES representation of citric acid?
The Canonical SMILES representation of citric acid is C(C(=O)O)C(CC(=O)O)(C(=O)O)O.
What is the CAS number for citric acid?
The CAS number for citric acid is 77-92-9.
What is the EU Food Improvement Agents number for citric acid?
The EU Food Improvement Agents number for citric acid is 201-069-1.
What is the FEMA Number for citric acid?
The FEMA Number for citric acid is 2306.