
What is the product name of CAS number 604-35-3?
The product name is Cholesterol acetate.
What is the molecular weight of Cholesterol acetate?
The molecular weight of Cholesterol acetate is 428.69.
What is the molecular formula of Cholesterol acetate?
The molecular formula of Cholesterol acetate is C29H48O2.
What is the melting point of Cholesterol acetate?
The melting point of Cholesterol acetate is 112-114 °C.
What is the density of Cholesterol acetate?
The density of Cholesterol acetate is 0.99g/ml.
What are the typical applications of Cholesterol acetate?
The typical applications of Cholesterol acetate are as a lipophilic viscosity increasing agent and skin conditioning agent.
What are some synonyms for Cholesterol acetate?
Some synonyms for Cholesterol acetate are Cholest-5-en-3-beta-yl acetate.
What is the InChI Key for Cholesterol acetate?
The InChI Key for Cholesterol acetate is InChI=1S/C29H48O2/c1-19(2)8-7-9-20(3)25-12-13-26-24-11-10-22-18-23(31-21(4)30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-20,23-27H,7-9,11-18H2,1-6H3/t20-,23+,24+,25-,26+,27+,28+,29-/m1/s1
What are the SMILES notations for Cholesterol acetate?
The SMILES notations for Cholesterol acetate are C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OC(=O)C)C)C.
What is the IUPAC Name of Cholesterol acetate?
The IUPAC Name of Cholesterol acetate is [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.