What is the product name of CAS number 791838-11-4?
The product name is Cetylhydroxyproline palmitamide.
What is the IUPAC name of Cetylhydroxyproline palmitamide?
The IUPAC name is Hexadecyl (2S,4R)-1-hexadecanoyl-4-hydroxypyrrolidine-2-carboxylate.
What is the molecular weight of Cetylhydroxyproline palmitamide?
The molecular weight is 593.96.
What is the molecular formula of Cetylhydroxyproline palmitamide?
The molecular formula is C37H71NO4.
What is the density of Cetylhydroxyproline palmitamide?
The density is 0.951±0.06g/ml.
What is the boiling point of Cetylhydroxyproline palmitamide?
The boiling point is 673.5±55.0 °C.
What is the percentage of actives in Cetylhydroxyproline palmitamide?
The percentage of actives is 95%.
What is the typical application of Cetylhydroxyproline palmitamide?
The typical application is skin conditioning.
What are some synonyms of Cetylhydroxyproline palmitamide?
Some synonyms include L-Proline, 4-hydroxy-1-(1-oxohexadecyl)-, hexadecyl ester, (4R)-.
What is the InChI Key of Cetylhydroxyproline palmitamide?
The InChI Key is InChI=1S/C37H71NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-42-37(41)35-32-34(39)33-38(35)36(40)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h34-35,39H,3-33H2,1-2H3/t34-,35+/m1/s1.