What is the CAS number of Cetyl lactate?
The CAS number of Cetyl lactate is 35274-05-6.
What are the synonyms for Cetyl lactate?
The synonyms for Cetyl lactate are N-Hexadecyl lactate and Hexadecyl 2-hydroxypropanoate.
What is the IUPAC name of Cetyl lactate?
The IUPAC name of Cetyl lactate is Hexadecyl 2-hydroxypropanoate.
What is the molecular weight of Cetyl lactate?
The molecular weight of Cetyl lactate is 314.5.
What is the molecular formula of Cetyl lactate?
The molecular formula of Cetyl lactate is C19H38O3.
What is the SMILES representation of Cetyl lactate?
The SMILES representation of Cetyl lactate is CCCCCCCCCCCCCCCCOC(=O)C(C)O.
What is the InChI Key of Cetyl lactate?
The InChI Key of Cetyl lactate is InChI=1S/C19H38O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-19(21)18(2)20/h18,20H,3-17H2,1-2H3.
What is the melting point of Cetyl lactate?
The melting point of Cetyl lactate is 41 °C.
What is the density of Cetyl lactate?
The density of Cetyl lactate is 1.02g/ml.
What are the typical applications of Cetyl lactate?
The typical applications of Cetyl lactate include use as a lubricant, dispersing agent, and emulsion stabilizer.
PAGE TOP