What is the IUPAC name of Cetyl dimethylbutyl ether?
The IUPAC name of Cetyl dimethylbutyl ether is 1-(4-Methylpentan-2-yloxy)hexadecane.
What is the molecular weight of Cetyl dimethylbutyl ether?
The molecular weight of Cetyl dimethylbutyl ether is 326.6.
What is the molecular formula of Cetyl dimethylbutyl ether?
The molecular formula of Cetyl dimethylbutyl ether is C22H46O.
What is the CAS number of Cetyl dimethylbutyl ether?
The CAS number of Cetyl dimethylbutyl ether is 185143-68-4.
What is the SMILES notation for Cetyl dimethylbutyl ether?
The SMILES notation for Cetyl dimethylbutyl ether is CCCCCCCCCCCCCCCCOC(C)CC(C)C.
What is the InChI Key for Cetyl dimethylbutyl ether?
The InChI Key for Cetyl dimethylbutyl ether is InChI=1S/C22H46O/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-22(4)20-21(2)3/h21-22H,5-20H2,1-4H3.
What is the physical state of Cetyl dimethylbutyl ether?
The physical state of Cetyl dimethylbutyl ether is liquid.
What is the percentage of actives in Cetyl dimethylbutyl ether?
The percentage of actives in Cetyl dimethylbutyl ether is 95%.
What are the typical applications of Cetyl dimethylbutyl ether?
The typical applications of Cetyl dimethylbutyl ether include skin conditioning.
What are some synonyms for Cetyl dimethylbutyl ether?
Some synonyms for Cetyl dimethylbutyl ether are Cetyl 1,3-dimethylbutyl ether.
PAGE TOP