
What is the CAS number for Cetyl acetate?
The CAS number for Cetyl acetate is 629-70-9.
What are some synonyms for Cetyl acetate?
Some synonyms for Cetyl acetate include 1-Hexadecanol, 1-acetate; 1-Hexadecanol, acetate; and Hexadecanol, acetate.
What is the molecular weight of Cetyl acetate?
The molecular weight of Cetyl acetate is 284.48.
What is the molecular formula of Cetyl acetate?
The molecular formula of Cetyl acetate is C18H36O2.
What is the SMILES representation of Cetyl acetate?
The SMILES representation of Cetyl acetate is CCCCCCCCCCCCCCCCOC(=O)C.
What is the InChI Key for Cetyl acetate?
The InChI Key for Cetyl acetate is InChI=1S/C18H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h3-17H2,1-2H3.
What is the boiling point of Cetyl acetate?
The boiling point of Cetyl acetate is 327 °C.
What is the melting point of Cetyl acetate?
The melting point of Cetyl acetate is 24 °C.
What is the density of Cetyl acetate?
The density of Cetyl acetate is 0.867 g/ml.
What are some typical applications of Cetyl acetate?
Some typical applications of Cetyl acetate include use as a lubricant and use as a dispersing agent or emulsion stabilizer.