What is the IUPAC name of Caprylyl butyrate?
The IUPAC name of Caprylyl butyrate is Octyl butanoate.
What is the CAS number of Caprylyl butyrate?
The CAS number of Caprylyl butyrate is 110-39-4.
What is the molecular formula of Caprylyl butyrate?
The molecular formula of Caprylyl butyrate is C12H24O2.
What is the boiling point of Caprylyl butyrate?
The boiling point of Caprylyl butyrate is 224 °C.
What is the melting point of Caprylyl butyrate?
The melting point of Caprylyl butyrate is -56 °C.
What is the density of Caprylyl butyrate?
The density of Caprylyl butyrate is 0.862g/ml.
What are some synonyms for Caprylyl butyrate?
Some synonyms for Caprylyl butyrate are N-Octyl butyrate, Butanoic acid, octyl ester, and Octyl butyrate.
What is the InChI Key for Caprylyl butyrate?
The InChI Key for Caprylyl butyrate is InChI=1S/C12H24O2/c1-3-5-6-7-8-9-11-14-12(13)10-4-2/h3-11H2,1-2H3.
What is the physical state of Caprylyl butyrate?
The physical state of Caprylyl butyrate is liquid.
What are some typical applications of Caprylyl butyrate?
Some typical applications of Caprylyl butyrate are its use as a solvent, cleansing agent, and perfume.
PAGE TOP