What is the CAS number for Caprylic/capric glycerides?
The CAS number for Caprylic/capric glycerides is 73398-61-5.
What are some synonyms for Caprylic/capric glycerides?
Some synonyms for Caprylic/capric glycerides are Glycerides, mixed decanoyl and octanoyl.
What is the IUPAC name of Caprylic/capric glycerides?
The IUPAC name of Caprylic/capric glycerides is 11-(2,3-dihydroxypropoxycarbonyl)heptadecanoate.
What is the density of Caprylic/capric glycerides?
The density of Caprylic/capric glycerides is 0.94-0.96g/ml.
What is the percentage of actives in Caprylic/capric glycerides?
The percentage of actives in Caprylic/capric glycerides is 95%.
In what physical state is Caprylic/capric glycerides?
Caprylic/capric glycerides is in a liquid physical state.
What are the typical applications of Caprylic/capric glycerides?
The typical applications of Caprylic/capric glycerides are as a lubricant, dispersing agent, and emulsion stabilizer.
What is the SMILES representation of Caprylic/capric glycerides?
The SMILES representation of Caprylic/capric glycerides is CCCCCCC(CCCCCCCCCC(=O)[O-])C(=O)OCC(CO)O.
What is the InChI key for Caprylic/capric glycerides?
The InChI key for Caprylic/capric glycerides is InChI=1S/C21H40O6/c1-2-3-4-10-13-18(21(26)27-17-19(23)16-22)14-11-8-6-5-7-9-12-15-20(24)25/h18-19,22-23H,2-17H2,1H3,(H,24,25)/p-1.
How can Caprylic/capric glycerides be used?
Caprylic/capric glycerides can be used as a lubricant, dispersing agent, and emulsion stabilizer.
PAGE TOP