What is the molecular formula of Butyl acetyl ricinoleate?
The molecular formula of Butyl acetyl ricinoleate is C24H44O4.
What is the molecular weight of Butyl acetyl ricinoleate?
The molecular weight of Butyl acetyl ricinoleate is 396.6 g/mol.
What are some synonyms for Butyl acetyl ricinoleate?
Some synonyms for Butyl acetyl ricinoleate include Flexricin P, Baryl Butyl O-acetylricinoleate.
What is the IUPAC name of Butyl acetyl ricinoleate?
The IUPAC name of Butyl acetyl ricinoleate is butyl (Z,12R)-12-acetyloxyoctadec-9-enoate.
What is the InChIKey of Butyl acetyl ricinoleate?
The InChIKey of Butyl acetyl ricinoleate is BEWFIPLBFJGWSR-AONZOJHOSA-N.
What is the Canonical SMILES of Butyl acetyl ricinoleate?
The Canonical SMILES of Butyl acetyl ricinoleate is CCCCCCC(CC=CCCCCCCCC(=O)OCCCC)OC(=O)C.
How many hydrogen bond acceptors does Butyl acetyl ricinoleate have?
Butyl acetyl ricinoleate has 4 hydrogen bond acceptors.
What is the XLogP3-AA value of Butyl acetyl ricinoleate?
The XLogP3-AA value of Butyl acetyl ricinoleate is 7.9.
How many rotatable bonds does Butyl acetyl ricinoleate have?
Butyl acetyl ricinoleate has 21 rotatable bonds.
What is the topological polar surface area of Butyl acetyl ricinoleate?
The topological polar surface area of Butyl acetyl ricinoleate is 52.6Ų.