What is the CAS number for Butanedioic acid, bis(2-ethylhexyl) ester?
The CAS number is 2915-57-3.
What are some synonyms for Butanedioic acid, bis(2-ethylhexyl) ester?
Some synonyms include Di(2-ethylhexyl) succinate, Diethylhexyl succinate, and Bis(2-ethylhexyl) succinate.
What is the IUPAC name for Butanedioic acid, bis(2-ethylhexyl) ester?
The IUPAC name is Bis(2-ethylhexyl) butanedioate.
What is the molecular weight of Butanedioic acid, bis(2-ethylhexyl) ester?
The molecular weight is 342.51.
What is the molecular formula of Butanedioic acid, bis(2-ethylhexyl) ester?
The molecular formula is C20H38O4.
What is the boiling point of Butanedioic acid, bis(2-ethylhexyl) ester?
The boiling point is 206-208 °C.
What is the density of Butanedioic acid, bis(2-ethylhexyl) ester?
The density is 0.933g/ml.
What are some typical applications of Butanedioic acid, bis(2-ethylhexyl) ester?
It is used as a lubricant, dispersing agent, emulsion stabilizer, and plasticizer.
What is the percentage of actives in Butanedioic acid, bis(2-ethylhexyl) ester?
The percentage of actives is 95%.
What is the InChI Key for Butanedioic acid, bis(2-ethylhexyl) ester?
The InChI Key is InChI=1S/C20H38O4/c1-5-9-11-17(7-3)15-23-19(21)13-14-20(22)24-16-18(8-4)12-10-6-2/h17-18H,5-16H2,1-4H3.
PAGE TOP