What is the molecular formula of Bis(2-methylpropyl) hexanedioate?
The molecular formula of Bis(2-methylpropyl) hexanedioate is C14H26O4.
What are some synonyms for Bis(2-methylpropyl) hexanedioate?
Some synonyms for Bis(2-methylpropyl) hexanedioate are Diisobutyl adipate, Diisobutyl hexanedioate, Hexanedioic acid, bis(2-methylpropyl) ester, and Hexanedioic acid, diisobutyl ester.
What is the IUPAC name of Bis(2-methylpropyl) hexanedioate?
The IUPAC name of Bis(2-methylpropyl) hexanedioate is Bis(2-methylpropyl) hexanedioate.
What is the molecular weight of Bis(2-methylpropyl) hexanedioate?
The molecular weight of Bis(2-methylpropyl) hexanedioate is 258.35.
What is the boiling point of Bis(2-methylpropyl) hexanedioate?
The boiling point of Bis(2-methylpropyl) hexanedioate is 293 °C.
What is the melting point of Bis(2-methylpropyl) hexanedioate?
The melting point of Bis(2-methylpropyl) hexanedioate is -17 °C.
What is the density of Bis(2-methylpropyl) hexanedioate?
The density of Bis(2-methylpropyl) hexanedioate is 0.954g/ml.
What are the typical applications of Bis(2-methylpropyl) hexanedioate?
The typical applications of Bis(2-methylpropyl) hexanedioate are as a solvent, dispersing agent, emulsion stabilizer, and plasticizer.
What is the percentage of actives in Bis(2-methylpropyl) hexanedioate?
The percentage of actives in Bis(2-methylpropyl) hexanedioate is 95%.
What is the InChI Key of Bis(2-methylpropyl) hexanedioate?
The InChI Key of Bis(2-methylpropyl) hexanedioate is InChI=1S/C14H26O4/c1-11(2)9-17-13(15)7-5-6-8-14(16)18-10-12(3)4/h11-12H,5-10H2,1-4H3.