What is the IUPAC name of Bis(16-methylheptadecyl) hydroxybutanedioate?
The IUPAC name is Bis(16-methylheptadecyl) 2-hydroxybutanedioate.
What is the CAS number of Bis(16-methylheptadecyl) hydroxybutanedioate?
The CAS number is 67763-18-2.
What are some synonyms for Bis(16-methylheptadecyl) hydroxybutanedioate?
Some synonyms for Bis(16-methylheptadecyl) hydroxybutanedioate are Diisostearyl malate, Bis(16-methylheptadecyl) malate, and Butanedioic acid, 2-hydroxy-, 1,4-bis(16-methylheptadecyl) ester.
What is the molecular weight of Bis(16-methylheptadecyl) hydroxybutanedioate?
The molecular weight is 639.04.
What is the molecular formula of Bis(16-methylheptadecyl) hydroxybutanedioate?
The molecular formula is C40H78O5.
What is the SMILES notation of Bis(16-methylheptadecyl) hydroxybutanedioate?
The SMILES is CC(C)CCCCCCCCCCCCCCCOC(=O)CC(C(=O)OCCCCCCCCCCCCCCCC(C)C)O.
What is the InChI Key of Bis(16-methylheptadecyl) hydroxybutanedioate?
The InChI Key of Bis(16-methylheptadecyl) hydroxybutanedioate is InChI=1S/C40H78O5/c1-36(2)31-27-23-19-15-11-7-5-9-13-17-21-25-29-33-44-39(42)35-38(41)40(43)45-34-30-26-22-18-14-10-6-8-12-16-20-24-28-32-37(3)4/h36-38,41H,5-35H2,1-4H3.
What is the boiling point of Bis(16-methylheptadecyl) hydroxybutanedioate?
The boiling point is 676.3±35.0 °C.
What is the density of Bis(16-methylheptadecyl) hydroxybutanedioate?
The density is 0.92±0.06g/ml.
What are some typical applications of Bis(16-methylheptadecyl) hydroxybutanedioate?
Some typical applications of Bis(16-methylheptadecyl) hydroxybutanedioate are its use as a lubricant, dispersing agent, emulsion stabilizer, and plasticizer.
PAGE TOP