What is the product name of the chemical with CAS number 5444-75-7?
The product name is Benzoic acid, 2-ethylhexyl ester.
What are the synonyms for Benzoic acid, 2-ethylhexyl ester?
The synonyms are 2-Ethylhexyl benzoate and Ethylhexyl benzoate.
What is the IUPAC name of Benzoic acid, 2-ethylhexyl ester?
The IUPAC name is 2-Ethylhexyl benzoate.
What is the molecular weight of Benzoic acid, 2-ethylhexyl ester?
The molecular weight is 234.33.
What is the molecular formula of Benzoic acid, 2-ethylhexyl ester?
The molecular formula is C15H22O2.
What is the boiling point of Benzoic acid, 2-ethylhexyl ester?
The boiling point is 170 °C at 20mmHg.
What is the density of Benzoic acid, 2-ethylhexyl ester?
The density is 0.97g/ml.
What is the percentage of actives in Benzoic acid, 2-ethylhexyl ester?
The percentage of actives is 95%.
What are some typical applications of Benzoic acid, 2-ethylhexyl ester?
Some typical applications include use as a dispersing agent, emulsion stabilizer, solubilizing agent, and plasticizer.
What is the InChI Key of Benzoic acid, 2-ethylhexyl ester?
The InChI Key is InChI=1S/C15H22O2/c1-3-5-9-13(4-2)12-17-15(16)14-10-7-6-8-11-14/h6-8,10-11,13H,3-5,9,12H2,1-2H3.
PAGE TOP