What is the PubChem CID for Azulene?
PubChem CID for Azulene is 9231.
What is the molecular formula of Azulene?
The molecular formula of Azulene is C10H8.
What is the molecular weight of Azulene?
The molecular weight of Azulene is 128.17 g/mol.
What are the synonyms for Azulene?
The synonyms for Azulene are azulene, Cyclopentacycloheptene, Azunamic, Bicyclo[5.3.0]decapentaene.
What is the IUPAC name of Azulene?
The IUPAC name of Azulene is azulene.
What is the InChI code for Azulene?
The InChI code for Azulene is InChI=1S/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H.
What is the canonical SMILES code for Azulene?
The canonical SMILES code for Azulene is C1=CC=C2C=CC=C2C=C1.
What is the CAS number for Azulene?
The CAS number for Azulene is 275-51-4.
What is the UNII number for Azulene?
The UNII number for Azulene is 82R6M9MGLP.
What is the molecular weight of Azulene according to PubChem?
According to PubChem, the molecular weight of Azulene is 128.17 g/mol.
PAGE TOP