What is the chemical name of the compound with CAS number 53448-53-6?
The chemical name of the compound with CAS number 53448-53-6 is Anhydroxylitol.
What are some synonyms for Anhydroxylitol?
Some synonyms for Anhydroxylitol are D-Xylitol and 1,4-Anhydro-D-xylitol.
What is the molecular weight of Anhydroxylitol?
The molecular weight of Anhydroxylitol is 134.13.
What is the molecular formula of Anhydroxylitol?
The molecular formula of Anhydroxylitol is C5H10O4.
What is the boiling point of Anhydroxylitol?
The boiling point of Anhydroxylitol is 160 °C at 0.2mmHg.
What is the density of Anhydroxylitol?
The density of Anhydroxylitol is 1.453±0.06g/ml.
What are the typical applications of Anhydroxylitol?
The typical applications of Anhydroxylitol include use as a dispersing agent and emulsifying agent, as well as an intermediate in organic synthesis.
What is the percentage of actives in Anhydroxylitol?
The percentage of actives in Anhydroxylitol is 95%.
What is the InChI Key for Anhydroxylitol?
The InChI Key for Anhydroxylitol is InChI=1S/C5H10O4/c6-1-4-5(8)3(7)2-9-4/h3-8H,1-2H2/t3-,4+,5+/m0/s1.
What is the physical state of Anhydroxylitol?
The physical state of Anhydroxylitol is a solid.
PAGE TOP