What is the product name of the chemical compound with CAS number 68140-00-1?
The product name is Amides, coco, N-(2-hydroxyethyl).
What are some synonyms for Amides, coco, N-(2-hydroxyethyl)?
Some synonyms include Cocamide MEA, Coco monoethanolamide, and Coconut fatty acid monoethanolamide.
What is the IUPAC name of this compound?
The IUPAC name is N-(2-hydroxyethyl)dodecanamide.
What is the melting point of Amides, coco, N-(2-hydroxyethyl)?
The melting point is 65-67 °C.
What is the percentage of actives in this compound?
The percentage of actives is 95%.
What is the physical state of Amides, coco, N-(2-hydroxyethyl)?
It is a solid.
What are some typical applications of this compound?
Some typical applications include use as a cleansing agent, emulsifying agent, and solubilizing agent.
What is the chemical structure of Amides, coco, N-(2-hydroxyethyl)?
The chemical structure is CCCCCCCCCCCC(=O)NCCO.
What is the InChI Key of this compound?
The InChI Key is InChI=1S/C14H29NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)15-12-13-16/h16H,2-13H2,1H3,(H,15,17).
What are some specific uses of Amides, coco, N-(2-hydroxyethyl) in industries?
It can be used as a cleansing agent, emulsifying agent, and solubilizing agent in various industries.
PAGE TOP