What is the chemical name of the compound with CAS number 93-92-5?
The chemical name of the compound with CAS number 93-92-5 is Alpha-Methylbenzyl acetate.
What are some synonyms for Alpha-Methylbenzyl acetate?
Some synonyms for Alpha-Methylbenzyl acetate include Methylbenzyl acetate, 1-Phenylethyl acetate, and Styrallyl acetate.
What is the IUPAC name of Alpha-Methylbenzyl acetate?
The IUPAC name of Alpha-Methylbenzyl acetate is 1-Phenylethyl acetate.
What is the molecular weight of Alpha-Methylbenzyl acetate?
The molecular weight of Alpha-Methylbenzyl acetate is 164.2.
What is the molecular formula of Alpha-Methylbenzyl acetate?
The molecular formula of Alpha-Methylbenzyl acetate is C10H12O2.
What is the SMILES notation for Alpha-Methylbenzyl acetate?
The SMILES notation for Alpha-Methylbenzyl acetate is CC(C1=CC=CC=C1)OC(=O)C.
What is the InChI key for Alpha-Methylbenzyl acetate?
The InChI key for Alpha-Methylbenzyl acetate is InChI=1S/C10H12O2/c1-8(12-9(2)11)10-6-4-3-5-7-10/h3-8H,1-2H3.
What is the boiling point of Alpha-Methylbenzyl acetate?
The boiling point of Alpha-Methylbenzyl acetate is 94-95 °C at 12mmHg (literature value).
What is the melting point of Alpha-Methylbenzyl acetate?
The melting point of Alpha-Methylbenzyl acetate is -60 °C.
What are some typical applications of Alpha-Methylbenzyl acetate?
Some typical applications of Alpha-Methylbenzyl acetate include use as a perfume, use as a solvent, and use as a cleansing agent or paint remover.
PAGE TOP