
What is the product name of CAS number 103-05-9?
The product name is Alpha,alpha-Dimethylbenzenepropanol.
What are some synonyms for Alpha,alpha-Dimethylbenzenepropanol?
Some synonyms include 1-Propanol, 1,1-dimethyl-3-phenyl-, 2-Butanol, 2-methyl-4-phenyl-, and Methyl phenylbutanol.
What is the molecular weight of Alpha,alpha-Dimethylbenzenepropanol?
The molecular weight is 164.24.
What is the molecular formula of Alpha,alpha-Dimethylbenzenepropanol?
The molecular formula is C11H16O.
What percentage of actives does Alpha,alpha-Dimethylbenzenepropanol contain?
Alpha,alpha-Dimethylbenzenepropanol contains 95% actives.
What is the physical state of Alpha,alpha-Dimethylbenzenepropanol?
It is in a liquid state.
What are the typical applications of Alpha,alpha-Dimethylbenzenepropanol?
It is used as a perfume and as an intermediate in organic synthesis.
What is the FEMA number associated with Alpha,alpha-Dimethylbenzenepropanol?
The FEMA number is 3629.
How many carbon atoms are present in the molecular formula of Alpha,alpha-Dimethylbenzenepropanol?
There are 11 carbon atoms in the formula.
What is the chemical structure of Alpha,alpha-Dimethylbenzenepropanol?
The chemical structure can be represented as C6H5-CH(CH3)-CH(CH3)-CH2OH.