What is the CAS number of 9-Octadecenoic acid (9Z)-, isodecyl ester?
The CAS number of 9-Octadecenoic acid (9Z)-, isodecyl ester is 59231-34-4.
What are some synonyms for 9-Octadecenoic acid (9Z)-, isodecyl ester?
Some synonyms for 9-Octadecenoic acid (9Z)-, isodecyl ester are 9-Octadecenoic acid, isodecyl ester.
What is the IUPAC name of 9-Octadecenoic acid (9Z)-, isodecyl ester?
The IUPAC name of 9-Octadecenoic acid (9Z)-, isodecyl ester is 8-Methylnonyl octadec-9-enoate.
What is the molecular weight of 9-Octadecenoic acid (9Z)-, isodecyl ester?
The molecular weight of 9-Octadecenoic acid (9Z)-, isodecyl ester is 422.73.
What is the molecular formula of 9-Octadecenoic acid (9Z)-, isodecyl ester?
The molecular formula of 9-Octadecenoic acid (9Z)-, isodecyl ester is C28H54O2.
What is the SMILES representation of 9-Octadecenoic acid (9Z)-, isodecyl ester?
The SMILES representation of 9-Octadecenoic acid (9Z)-, isodecyl ester is CCCCCCCCC=CCCCCCCCC(=O)OCCCCCCCC(C)C.
What is the InChI Key of 9-Octadecenoic acid (9Z)-, isodecyl ester?
The InChI Key of 9-Octadecenoic acid (9Z)-, isodecyl ester is InChI=1S/C28H54O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22-25-28(29)30-26-23-20-17-18-21-24-27(2)3/h11-12,27H,4-10,13-26H2,1-3H3.
What is the active percentage of 9-Octadecenoic acid (9Z)-, isodecyl ester?
The active percentage of 9-Octadecenoic acid (9Z)-, isodecyl ester is 95%.
In what physical state is 9-Octadecenoic acid (9Z)-, isodecyl ester?
9-Octadecenoic acid (9Z)-, isodecyl ester is in the solid physical state.
What are some typical applications of 9-Octadecenoic acid (9Z)-, isodecyl ester?
Some typical applications of 9-Octadecenoic acid (9Z)-, isodecyl ester are as a solvent, synthetic ester, and for skin conditioning.
PAGE TOP