What is the IUPAC name of 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester?
The IUPAC name of is 2-Ethylhexyl (Z)-octadec-9-enoate.
What is the CAS number of 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester?
The CAS number of is 26399-02-0.
What is the molecular weight of 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester?
The molecular weight of is 394.67.
What is the molecular formula of 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester?
The molecular formula of is C26H50O2.
What is the SMILES notation for 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester?
The SMILES is CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CC)CCCC.
What is the InChI Key for 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester?
The InChI Key for 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester is InChI=1S/C26H50O2/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-20-21-23-26(27)28-24-25(6-3)22-8-5-2/h14-15,25H,4-13,16-24H2,1-3H3/b15-14-
What is the boiling point of 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester?
The boiling point of 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester is 465.5±24.0 °C.
What is the density of 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester?
The density of 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester is 0.867±0.06g/ml.
What percentage of actives does 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester contain?
9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester contains 95% actives.
What are the typical applications of 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester?
The typical applications of 9-Octadecenoic acid (9Z)-, 2-ethylhexyl ester include use as an emulsifying agent, dispersing agent, solubilizing agent, and lubricant.
PAGE TOP