What is the IUPAC name of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester?
The IUPAC name is Bis(2-octyldodecyl) (Z)-hexatriacont-18-enedioate.
What is the molecular weight of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester?
The molecular weight is 1125.99.
What is the molecular formula of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester?
The molecular formula is C76H148O4.
What are the synonyms of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester?
The synonyms of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester are Dioctyldodecyl dimer dilinoleate.
What is the CAS number of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester?
The CAS number is 129423-60-5.
What are the typical applications of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester?
The typical applications of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester include being an emollient.
What is the SMILES notation of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester?
The SMILES notation of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester is CCCCCCCCCCC(CCCCCCCC)COC(=O)CCCCCCCCCCCCCCCC/C=C\CCCCCCCCCCCCCCCCC(=O)OCC(CCCCCCCC)CCCCCCCCCC.
What is the InChI of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester?
The InChI of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester is IHURUMZMADFAGS-VHXPQNKSSA-N.
What is the InChI Key of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester?
The InChI Key of 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester is InChI=1S/C76H148O4/c1-5-9-13-17-21-49-55-61-67-73(65-59-53-19-15-11-7-3)71-79-75(77)69-63-57-51-47-45-43-41-39-37-35-33-31-29-27-25-23-24-26-28-30-32-34-36-38-40-42-44-46-48-52-58-64-70-76(78)80-72-74(66-60-54-20-16-12-8-4)68-62-56-50-22-18-14-10-6-2/h23-24,73-74H,5-22,25-72H2,1-4H3/b24-23-.
What is the percentage of actives in 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester?
The percentage of actives in 9,12-Octadecadienoic acid dimer (Z,Z)-, octyldodecyl diester is 95%.
PAGE TOP