What is the product name of the compound with CAS number 35474-99-8?
The product name is 5,8,11,14-Eicosatetraenoic acid, 2,3-dihydroxypropyl ester, (all-Z).
What is the IUPAC name of this compound?
The IUPAC name is 2,3-Dihydroxypropyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
What is the molecular weight of the compound?
The molecular weight is 378.55.
What is the molecular formula of the compound?
The molecular formula is C23H38O4.
What is the boiling point of the compound?
The boiling point is 508.5±50.0 °C.
What is the melting point of the compound?
The melting point is 81.5 °C.
What is the density of the compound?
The density is 0.992±0.06g/ml.
What are some synonyms for this compound?
Some synonyms include 1-Arachidonyl monoglyceride, Glyceryl arachidonate, and Glyceryl monoarachidonate.
What is the SMILES representation of the compound?
The SMILES representation is CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC(CO)O.
What are some typical applications for this compound?
Some typical applications include use as a lubricant, dispersing agent, and emulsion stabilizer.
PAGE TOP