What is the CAS number of 4-Nonylphenol polyethylene glycol ether?
The CAS number is 26027-38-3.
What are some synonyms for 4-Nonylphenol polyethylene glycol ether?
Synonyms include Polyethylene glycol mono(p-nonylphenyl) ether, Ethoxylated p-nonyl phenol, Nonoxynol, PEG Nonyl phenyl ether, and more.
What is the molecular formula of 4-Nonylphenol polyethylene glycol ether?
The molecular formula is (C2H4O)n.C15H24O.
What is the melting point of 4-Nonylphenol polyethylene glycol ether?
The melting point is 30°C.
What is the density of 4-Nonylphenol polyethylene glycol ether?
The density is 1.0g/ml.
What are some typical applications of 4-Nonylphenol polyethylene glycol ether?
They include use as a cleansing agent in personal care products, household cleaning, industrial cleaning, textile, leather, and chemical fiber. Also, it is used as an emulsifying agent and dispersing agent.
What is the percentage of actives in 4-Nonylphenol polyethylene glycol ether?
The actives are 95%.
What is the IUPAC name of 4-Nonylphenol polyethylene glycol ether?
The IUPAC name is 2-(4-Nonylphenoxy)ethanol.
What is the molecular structure of 4-Nonylphenol polyethylene glycol ether in the SMILES representation?
The SMILES representation is CCCCCCCCCC1=CC=C(C=C1)OCCO.
How is 4-Nonylphenol polyethylene glycol ether primarily used?
It is primarily used as a cleansing agent in various products and as an emulsifying and dispersing agent.
PAGE TOP