What is the IUPAC name of the product 4,4'-Biphenol?
The IUPAC name of the product 4,4'-Biphenol is 4-(4-hydroxyphenyl)phenol.
What is the molecular weight of 4,4'-Biphenol?
The molecular weight of 4,4'-Biphenol is 186.21.
What is the molecular formula of 4,4'-Biphenol?
The molecular formula of 4,4'-Biphenol is C12H10O2.
What is the CAS number of 4,4'-Biphenol?
The CAS number of 4,4'-Biphenol is 92-88-6.
What is the physical state of 4,4'-Biphenol?
The physical state of 4,4'-Biphenol is solid.
What is the melting point of 4,4'-Biphenol?
The melting point of 4,4'-Biphenol is 283.0 °C.
What are the SMILES notations for 4,4'-Biphenol?
The SMILES notations for 4,4'-Biphenol are C1=CC(=CC=C1C2=CC=C(C=C2)O)O.
What are the typical applications of 4,4'-Biphenol?
The typical applications of 4,4'-Biphenol include its use as an antioxidant.
What percentage of actives does 4,4'-Biphenol contain?
4,4'-Biphenol contains 95% actives.
What is the InChI Key of 4,4'-Biphenol?
The InChI Key of 4,4'-Biphenol is VCCBEIPGXKNHFW-UHFFFAOYSA-N.
PAGE TOP