What is the product name of CAS number 32923-88-9?
The product name is 3-Isobutoxy-1-propylamine.
What are some synonyms for 3-Isobutoxy-1-propylamine?
Some synonyms include 3-Isobutoxypropylamine and 3-(2-Methylpropoxy)propan-1-amine.
What is the molecular weight of 3-Isobutoxy-1-propylamine?
The molecular weight is 131.22.
What is the molecular formula of 3-Isobutoxy-1-propylamine?
The molecular formula is C7H17NO.
What is the SMILES notation for 3-Isobutoxy-1-propylamine?
The SMILES notation is CC(C)COCCCN.
What is the InChI for 3-Isobutoxy-1-propylamine?
The InChI is InChI=1S/C7H17NO/c1-7(2)6-9-5-3-4-8/h7H,3-6,8H2,1-2H3.
What is the physical state of 3-Isobutoxy-1-propylamine?
The physical state is a liquid.
What are some typical applications of 3-Isobutoxy-1-propylamine?
It can be used as a cleansing agent, solvent, emulsifying agent, and dispersing agent.
What is the percentage of actives in 3-Isobutoxy-1-propylamine?
The percentage of actives is 95%.
How can 3-Isobutoxy-1-propylamine be used in industrial applications?
It can be used for cleaning, as a solvent, and for emulsifying and dispersing in various industrial processes.
PAGE TOP