What is the IUPAC name of 3-Iodo-2-propynyl butylcarbamate?
The IUPAC name of 3-Iodo-2-propynyl butylcarbamate is 3-Iodoprop-2-ynyl N-butylcarbamate.
What is the molecular weight of 3-Iodo-2-propynyl butylcarbamate?
The molecular weight of 3-Iodo-2-propynyl butylcarbamate is 281.09.
What is the molecular formula of 3-Iodo-2-propynyl butylcarbamate?
The molecular formula of 3-Iodo-2-propynyl butylcarbamate is C8H12INO2.
What is the Synonyms of 3-Iodo-2-propynyl butylcarbamate?
The Synonyms of 3-Iodo-2-propynyl butylcarbamate is Iodocarb.
What is the CAS number of 3-Iodo-2-propynyl butylcarbamate?
The CAS number of 3-Iodo-2-propynyl butylcarbamate is 55406-53-6.
What is the InChI of 3-Iodo-2-propynyl butylcarbamate?
The InChI of 3-Iodo-2-propynyl butylcarbamate is InChI=1S/C8H12INO2/c1-2-3-6-10-8(11)12-7-4-5-9/h2-3,6-7H2,1H3,(H,10,11).
What is the boiling point of 3-Iodo-2-propynyl butylcarbamate?
The boiling point of 3-Iodo-2-propynyl butylcarbamate is 321.8±25.0 °C.
What is the melting point of 3-Iodo-2-propynyl butylcarbamate?
The melting point of 3-Iodo-2-propynyl butylcarbamate is 65-68 °C.
What is the density of 3-Iodo-2-propynyl butylcarbamate?
The density of 3-Iodo-2-propynyl butylcarbamate is 1.606±0.06 g/cm3.
What are the typical applications of 3-Iodo-2-propynyl butylcarbamate?
The typical applications of 3-Iodo-2-propynyl butylcarbamate include its use as an antimicrobial agent and preservative.
PAGE TOP