What is the IUPAC name for 2-Octyldodecyl stearate?
The IUPAC name for 2-Octyldodecyl stearate is 2-Octyldodecyl octadecanoate.
What is the molecular weight of 2-Octyldodecyl stearate?
The molecular weight of 2-Octyldodecyl stearate is 565.01.
What is the molecular formula of 2-Octyldodecyl stearate?
The molecular formula of 2-Octyldodecyl stearate is C38H76O2.
What is the CAS number for 2-Octyldodecyl stearate?
The CAS number for 2-Octyldodecyl stearate is 22766-82-1.
What is the boiling point of 2-Octyldodecyl stearate?
The boiling point of 2-Octyldodecyl stearate is 563.5±18.0 °C.
What is the density of 2-Octyldodecyl stearate?
The density of 2-Octyldodecyl stearate is 0.856±0.06 g/ml.
What are some typical applications of 2-Octyldodecyl stearate?
Some typical applications of 2-Octyldodecyl stearate include use as an emulsifying agent, dispersing agent, solubilizing agent, and lubricant.
What are some synonyms for 2-Octyldodecyl stearate?
Some synonyms for 2-Octyldodecyl stearate are Octyldodecyl Stearate and Octadecanoic acid, 2-octyldodecyl ester.
What is the InChI Key for 2-Octyldodecyl stearate?
The InChI Key for 2-Octyldodecyl stearate is InChI=1S/C38H76O2/c1-4-7-10-13-16-18-19-20-21-22-23-24-26-29-32-35-38(39)40-36-37(33-30-27-15-12-9-6-3)34-31-28-25-17-14-11-8-5-2/h37H,4-36H2,1-3H3.
What percentage of actives does 2-Octyldodecyl stearate contain?
2-Octyldodecyl stearate contains 95% actives.