
What is the product name of the compound with CAS number 55302-96-0?
The product name is 2-Methyl-5-hydroxyethylaminophenol.
What is the molecular weight of 2-Methyl-5-hydroxyethylaminophenol?
The molecular weight is 167.21.
What is the molecular formula of 2-Methyl-5-hydroxyethylaminophenol?
The molecular formula is C9H13NO2.
What are the synonyms for 2-Methyl-5-hydroxyethylaminophenol?
The synonyms are 5-((2-Hydroxyethyl)amino)-2-methylphenol and 5-(2-Hydroxyethylamino)-2-methylphenol.
What is the InChI Key for 2-Methyl-5-hydroxyethylaminophenol?
The InChI Key is InChI=1S/C9H13NO2/c1-7-2-3-8(6-9(7)12)10-4-5-11/h2-3,6,10-12H,4-5H2,1H3.
What is the boiling point of 2-Methyl-5-hydroxyethylaminophenol?
The boiling point is 366.0±32.0 °C.
What is the melting point of 2-Methyl-5-hydroxyethylaminophenol?
The melting point is 90-92 °C.
What percentage of actives does 2-Methyl-5-hydroxyethylaminophenol have?
It has 95% actives.
What is the physical state of 2-Methyl-5-hydroxyethylaminophenol at room temperature?
It is in a solid state.
What are some typical applications of 2-Methyl-5-hydroxyethylaminophenol?
It is used as a dispersing agent, emulsion stabilizer, and as an intermediate in organic synthesis.