What is the product name of CAS number 142-55-2?
The product name is 2-Hydroxypropyl laurate.
What are the synonyms for 2-Hydroxypropyl laurate?
The synonyms are Dodecanoic acid, 2-hydroxypropyl ester and Propylene glycol laurate.
What is the molecular weight of 2-Hydroxypropyl laurate?
The molecular weight is 258.4.
What is the molecular formula of 2-Hydroxypropyl laurate?
The molecular formula is C15H30O3.
What is the IUPAC Name of 2-Hydroxypropyl laurate?
The IUPAC Name is 2-Hydroxypropyl dodecanoate.
What is the SMILES representation of 2-Hydroxypropyl laurate?
The SMILES representation is CCCCCCCCCCCC(=O)OCC(C)O.
What is the InChI Key of 2-Hydroxypropyl laurate?
The InChI Key is InChI=1S/C15H30O3/c1-3-4-5-6-7-8-9-10-11-12-15(17)18-13-14(2)16/h14,16H,3-13H2,1-2H3.
What is the boiling point of 2-Hydroxypropyl laurate?
The boiling point is 362.5±15.0 °C.
What is the density of 2-Hydroxypropyl laurate?
The density is 0.931±0.06g/ml.
What are the typical applications of 2-Hydroxypropyl laurate?
The typical applications include use as a lubricant, dispersing agent, and emulsion stabilizer.